C31H33N5O5 — CID 91005733
2-methyl-N-(2-morpholin-4-ylethyl)-N-[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]propanamide (PubChem CID 91005733) has the molecular formula C31H33N5O5 and a molecular weight of 555.64 g/mol. Its IUPAC name is 2-methyl-N-(2-morpholin-4-ylethyl)-N-[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]propanamide.
| Compound Name | 2-methyl-N-(2-morpholin-4-ylethyl)-N-[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 91005733 |
| Molecular Formula | C31H33N5O5 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | 2-methyl-N-(2-morpholin-4-ylethyl)-N-[4-[[(5-nitro-2-oxo-1,3-dihydroindol-3-yl)-phenylmethylidene]amino]phenyl]propanamide |
| SMILES | CC(C)C(=O)N(CCN1CCOCC1)c1ccc(/N=C(\c2ccccc2)C2C(=O)Nc3ccc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C31H33N5O5/c1-21(2)31(38)35(15-14-34-16-18-41-19-17-34)24-10-8-23(9-11-24)32-29(22-6-4-3-5-7-22)28-26-20-25(36(39)40)12-13-27(26)33-30(28)37/h3-13,20-21,28H,14-19H2,1-2H3,(H,33,37)/b32-29+ |
| InChIKey | FJLRZVXJQXCEPX-UUDCSCGESA-N |
| XLogP | 4.77 |
| TPSA | 117.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|