C29H25FN2O6 — CID 91271886
3-ethoxycarbonyl-8-[(4-fluorophenyl)methyl]-2-oxo-4-phenylmethoxy-1,6-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-11-carboxylic acid (PubChem CID 91271886) has the molecular formula C29H25FN2O6 and a molecular weight of 516.53 g/mol. Its IUPAC name is 3-ethoxycarbonyl-8-[(4-fluorophenyl)methyl]-2-oxo-4-phenylmethoxy-1,6-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-11-carboxylic acid.
| Compound Name | 3-ethoxycarbonyl-8-[(4-fluorophenyl)methyl]-2-oxo-4-phenylmethoxy-1,6-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 91271886 |
| Molecular Formula | C29H25FN2O6 |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | 3-ethoxycarbonyl-8-[(4-fluorophenyl)methyl]-2-oxo-4-phenylmethoxy-1,6-diazatricyclo[7.3.1.05,13]trideca-3,5,7,9(13)-tetraene-11-carboxylic acid |
| SMILES | CCOC(=O)c1c(OCc2ccccc2)c2ncc(Cc3ccc(F)cc3)c3c2n(c1=O)CC(C(=O)O)C3 |
| InChI | InChI=1S/C29H25FN2O6/c1-2-37-29(36)23-26(38-16-18-6-4-3-5-7-18)24-25-22(13-20(28(34)35)15-32(25)27(23)33)19(14-31-24)12-17-8-10-21(30)11-9-17/h3-11,14,20H,2,12-13,15-16H2,1H3,(H,34,35) |
| InChIKey | UITOZXZPRCRUHI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |