C19H18FNO — CID 91272219
2-(6-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylethanone (PubChem CID 91272219) has the molecular formula C19H18FNO and a molecular weight of 295.36 g/mol. Its IUPAC name is 2-(6-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylethanone.
| Compound Name | 2-(6-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 91272219 |
| Molecular Formula | C19H18FNO |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-(6-fluoro-3,3-dimethyl-4H-isoquinolin-1-yl)-1-phenylethanone |
| SMILES | CC1(C)Cc2cc(F)ccc2C(CC(=O)c2ccccc2)=N1 |
| InChI | InChI=1S/C19H18FNO/c1-19(2)12-14-10-15(20)8-9-16(14)17(21-19)11-18(22)13-6-4-3-5-7-13/h3-10H,11-12H2,1-2H3 |
| InChIKey | YFWBVHPDMVUPII-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |