C17H14FNO — CID 134946117
N-[(2R)-2-fluoro-3,4-dihydro-2H-naphthalen-1-ylidene]benzamide (PubChem CID 134946117) has the molecular formula C17H14FNO and a molecular weight of 267.30 g/mol. Its IUPAC name is N-[(2R)-2-fluoro-3,4-dihydro-2H-naphthalen-1-ylidene]benzamide.
| Compound Name | N-[(2R)-2-fluoro-3,4-dihydro-2H-naphthalen-1-ylidene]benzamide |
|---|---|
| PubChem CID | 134946117 |
| Molecular Formula | C17H14FNO |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N-[(2R)-2-fluoro-3,4-dihydro-2H-naphthalen-1-ylidene]benzamide |
| SMILES | O=C(/N=C1/c2ccccc2CC[C@H]1F)c1ccccc1 |
| InChI | InChI=1S/C17H14FNO/c18-15-11-10-12-6-4-5-9-14(12)16(15)19-17(20)13-7-2-1-3-8-13/h1-9,15H,10-11H2/b19-16-/t15-/m1/s1 |
| InChIKey | GXLUPGKQNJUTCI-YGMPWRRSSA-N |
| XLogP | 3.60 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|