C24H20FNO — CID 134946116
N-[(2S)-2-benzyl-2-fluoro-3,4-dihydronaphthalen-1-ylidene]benzamide (PubChem CID 134946116) has the molecular formula C24H20FNO and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[(2S)-2-benzyl-2-fluoro-3,4-dihydronaphthalen-1-ylidene]benzamide.
| Compound Name | N-[(2S)-2-benzyl-2-fluoro-3,4-dihydronaphthalen-1-ylidene]benzamide |
|---|---|
| PubChem CID | 134946116 |
| Molecular Formula | C24H20FNO |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[(2S)-2-benzyl-2-fluoro-3,4-dihydronaphthalen-1-ylidene]benzamide |
| SMILES | O=C(/N=C1\c2ccccc2CC[C@]1(F)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20FNO/c25-24(17-18-9-3-1-4-10-18)16-15-19-11-7-8-14-21(19)22(24)26-23(27)20-12-5-2-6-13-20/h1-14H,15-17H2/b26-22+/t24-/m0/s1 |
| InChIKey | CWAPNATZPIONLB-AVQAENAPSA-N |
| XLogP | 5.21 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|