C17H13ClFNO — CID 134946118
N-[(2S)-2-chloro-2-fluoro-3,4-dihydronaphthalen-1-ylidene]benzamide (PubChem CID 134946118) has the molecular formula C17H13ClFNO and a molecular weight of 301.75 g/mol. Its IUPAC name is N-[(2S)-2-chloro-2-fluoro-3,4-dihydronaphthalen-1-ylidene]benzamide.
| Compound Name | N-[(2S)-2-chloro-2-fluoro-3,4-dihydronaphthalen-1-ylidene]benzamide |
|---|---|
| PubChem CID | 134946118 |
| Molecular Formula | C17H13ClFNO |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-[(2S)-2-chloro-2-fluoro-3,4-dihydronaphthalen-1-ylidene]benzamide |
| SMILES | O=C(/N=C1\c2ccccc2CC[C@]1(F)Cl)c1ccccc1 |
| InChI | InChI=1S/C17H13ClFNO/c18-17(19)11-10-12-6-4-5-9-14(12)15(17)20-16(21)13-7-2-1-3-8-13/h1-9H,10-11H2/b20-15+/t17-/m1/s1 |
| InChIKey | ZPHDZCLQGWEZGK-FABDANFUSA-N |
| XLogP | 4.17 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|