C21H13F3N2O2 — CID 101418153
N-[6-benzoylimino-4-(trifluoromethyl)cyclohexa-2,4-dien-1-ylidene]benzamide (PubChem CID 101418153) has the molecular formula C21H13F3N2O2 and a molecular weight of 382.34 g/mol. Its IUPAC name is N-[6-benzoylimino-4-(trifluoromethyl)cyclohexa-2,4-dien-1-ylidene]benzamide.
| Compound Name | N-[6-benzoylimino-4-(trifluoromethyl)cyclohexa-2,4-dien-1-ylidene]benzamide |
|---|---|
| PubChem CID | 101418153 |
| Molecular Formula | C21H13F3N2O2 |
| Molecular Weight | 382.34 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | N-[6-benzoylimino-4-(trifluoromethyl)cyclohexa-2,4-dien-1-ylidene]benzamide |
| SMILES | O=C(/N=C1\C=CC(C(F)(F)F)=C\C1=N/C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H13F3N2O2/c22-21(23,24)16-11-12-17(25-19(27)14-7-3-1-4-8-14)18(13-16)26-20(28)15-9-5-2-6-10-15/h1-13H/b25-17+,26-18+ |
| InChIKey | XWQUNZNXSNNRKZ-RPCRKUJJSA-N |
| XLogP | 4.61 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|