C30H37N3O — CID 91273650
1-[1-[3-(1H-benzimidazol-2-yl)-4-cyclobutylphenyl]piperidin-3-yl]-2-cyclohexylethanone (PubChem CID 91273650) has the molecular formula C30H37N3O and a molecular weight of 455.65 g/mol. Its IUPAC name is 1-[1-[3-(1H-benzimidazol-2-yl)-4-cyclobutylphenyl]piperidin-3-yl]-2-cyclohexylethanone.
| Compound Name | 1-[1-[3-(1H-benzimidazol-2-yl)-4-cyclobutylphenyl]piperidin-3-yl]-2-cyclohexylethanone |
|---|---|
| PubChem CID | 91273650 |
| Molecular Formula | C30H37N3O |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.29 |
| IUPAC Name | 1-[1-[3-(1H-benzimidazol-2-yl)-4-cyclobutylphenyl]piperidin-3-yl]-2-cyclohexylethanone |
| SMILES | O=C(CC1CCCCC1)C1CCCN(c2ccc(C3CCC3)c(-c3nc4ccccc4[nH]3)c2)C1 |
| InChI | InChI=1S/C30H37N3O/c34-29(18-21-8-2-1-3-9-21)23-12-7-17-33(20-23)24-15-16-25(22-10-6-11-22)26(19-24)30-31-27-13-4-5-14-28(27)32-30/h4-5,13-16,19,21-23H,1-3,6-12,17-18,20H2,(H,31,32) |
| InChIKey | BGGIURFZKFGQFZ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |