C30H38FN3O2 — CID 91273927
(3R,3aS,4S,5R,6S,7aR)-4-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-7a-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one (PubChem CID 91273927) has the molecular formula C30H38FN3O2 and a molecular weight of 491.65 g/mol. Its IUPAC name is (3R,3aS,4S,5R,6S,7aR)-4-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-7a-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one.
| Compound Name | (3R,3aS,4S,5R,6S,7aR)-4-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-7a-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 91273927 |
| Molecular Formula | C30H38FN3O2 |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | (3R,3aS,4S,5R,6S,7aR)-4-[2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]-3,5,6-trimethyl-7a-[(4-methylpiperazin-1-yl)methyl]-3,3a,4,5,6,7-hexahydro-2-benzofuran-1-one |
| SMILES | C[C@H]1[C@H](C=Cc2ccc(-c3cccc(F)c3)cn2)[C@@H]2[C@@H](C)OC(=O)[C@]2(CN2CCN(C)CC2)C[C@@H]1C |
| InChI | InChI=1S/C30H38FN3O2/c1-20-17-30(19-34-14-12-33(4)13-15-34)28(22(3)36-29(30)35)27(21(20)2)11-10-26-9-8-24(18-32-26)23-6-5-7-25(31)16-23/h5-11,16,18,20-22,27-28H,12-15,17,19H2,1-4H3/t20-,21+,22+,27-,28-,30-/m0/s1 |
| InChIKey | HLSYQOKIHDSSBJ-NYORZASCSA-N |
| XLogP | 4.99 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |