About 4-fluoro-7-prop-1-en-2-ylcyclohepta-1,2,4,6-tetraene
4-fluoro-7-prop-1-en-2-ylcyclohepta-1,2,4,6-tetraene (PubChem CID 91274206) has the molecular formula C10H9F
and a molecular weight of 148.18 g/mol. Its IUPAC name is 4-fluoro-7-prop-1-en-2-ylcyclohepta-1,2,4,6-tetraene.
Analyze 4-fluoro-7-prop-1-en-2-ylcyclohepta-1,2,4,6-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-7-prop-1-en-2-ylcyclohepta-1,2,4,6-tetraene?
The IUPAC name of 4-fluoro-7-prop-1-en-2-ylcyclohepta-1,2,4,6-tetraene (CID 91274206) is 4-fluoro-7-prop-1-en-2-ylcyclohepta-1,2,4,6-tetraene.
What is the SMILES notation for 4-fluoro-7-prop-1-en-2-ylcyclohepta-1,2,4,6-tetraene?
The canonical SMILES for 4-fluoro-7-prop-1-en-2-ylcyclohepta-1,2,4,6-tetraene is C=C(C)C1=CC=C(F)C=C=C1.
What is the InChIKey of 4-fluoro-7-prop-1-en-2-ylcyclohepta-1,2,4,6-tetraene?
The InChIKey is MVTGLSWVKPAPMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F/c1-8(2)9-4-3-5-10(11)7-6-9/h4-7H,1H2,2H3.
What are the key properties of 4-fluoro-7-prop-1-en-2-ylcyclohepta-1,2,4,6-tetraene?
4-fluoro-7-prop-1-en-2-ylcyclohepta-1,2,4,6-tetraene has a molecular weight of 148.18 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-7-prop-1-en-2-ylcyclohepta-1,2,4,6-tetraene is sourced from PubChem (CID 91274206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).