C19H25NO4 — CID 91275245
methyl 2-[(5,5-dimethyl-2-oxo-4-phenyloxolan-3-ylidene)amino]-4-methylpentanoate (PubChem CID 91275245) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is methyl 2-[(5,5-dimethyl-2-oxo-4-phenyloxolan-3-ylidene)amino]-4-methylpentanoate.
| Compound Name | methyl 2-[(5,5-dimethyl-2-oxo-4-phenyloxolan-3-ylidene)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 91275245 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | methyl 2-[(5,5-dimethyl-2-oxo-4-phenyloxolan-3-ylidene)amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)/N=C1\C(=O)OC(C)(C)C1c1ccccc1 |
| InChI | InChI=1S/C19H25NO4/c1-12(2)11-14(17(21)23-5)20-16-15(13-9-7-6-8-10-13)19(3,4)24-18(16)22/h6-10,12,14-15H,11H2,1-5H3/b20-16- |
| InChIKey | CHRMEZIRUYSVHG-SILNSSARSA-N |
| XLogP | 3.13 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|