C28H28ClF3N8OS — CID 91275749
N-(2-chloro-6-methylphenyl)-2-[[4-cyclopropyl-6-[4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-1,3-thiazole-5-carboxamide (PubChem CID 91275749) has the molecular formula C28H28ClF3N8OS and a molecular weight of 617.10 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-2-[[4-cyclopropyl-6-[4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-2-[[4-cyclopropyl-6-[4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 91275749 |
| Molecular Formula | C28H28ClF3N8OS |
| Molecular Weight | 617.10 g/mol |
| Exact Mass | 616.17 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-2-[[4-cyclopropyl-6-[4-[5-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]piperazin-1-yl]-1,3,5-triazin-2-yl]amino]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cccc(Cl)c1NC(=O)c1cnc(Nc2nc(C3CC3)nc(N3CCN(C4=CCCC(C(F)(F)F)=C4)CC3)n2)s1 |
| InChI | InChI=1S/C28H28ClF3N8OS/c1-16-4-2-7-20(29)22(16)34-24(41)21-15-33-27(42-21)38-25-35-23(17-8-9-17)36-26(37-25)40-12-10-39(11-13-40)19-6-3-5-18(14-19)28(30,31)32/h2,4,6-7,14-15,17H,3,5,8-13H2,1H3,(H,34,41)(H,33,35,36,37,38) |
| InChIKey | IYHLGUHTBPPVCD-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.10 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |