C23H38O2 — CID 91276610
2-butylidene-10-hydroxy-1-(2,6,6-trimethylcyclohexen-1-yl)dec-4-en-1-one (PubChem CID 91276610) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is 2-butylidene-10-hydroxy-1-(2,6,6-trimethylcyclohexen-1-yl)dec-4-en-1-one.
| Compound Name | 2-butylidene-10-hydroxy-1-(2,6,6-trimethylcyclohexen-1-yl)dec-4-en-1-one |
|---|---|
| PubChem CID | 91276610 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 2-butylidene-10-hydroxy-1-(2,6,6-trimethylcyclohexen-1-yl)dec-4-en-1-one |
| SMILES | CCCC=C(CC=CCCCCCO)C(=O)C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C23H38O2/c1-5-6-15-20(16-11-9-7-8-10-12-18-24)22(25)21-19(2)14-13-17-23(21,3)4/h9,11,15,24H,5-8,10,12-14,16-18H2,1-4H3 |
| InChIKey | FUXGULSXURBXCK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|