C10H17N — CID 91277402
2-methyl-N-(4-methylpent-2-en-3-yl)prop-2-en-1-imine (PubChem CID 91277402) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 2-methyl-N-(4-methylpent-2-en-3-yl)prop-2-en-1-imine.
| Compound Name | 2-methyl-N-(4-methylpent-2-en-3-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 91277402 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2-methyl-N-(4-methylpent-2-en-3-yl)prop-2-en-1-imine |
| SMILES | C=C(C)/C=N/C(=CC)C(C)C |
| InChI | InChI=1S/C10H17N/c1-6-10(9(4)5)11-7-8(2)3/h6-7,9H,2H2,1,3-5H3/b10-6?,11-7+ |
| InChIKey | BWCSMKYTDHMXQF-DPWZYIFFSA-N |
| XLogP | 3.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|