C16H23BrFNO2Si — CID 91278612
[3-(4-bromo-3-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 91278612) has the molecular formula C16H23BrFNO2Si and a molecular weight of 388.35 g/mol. Its IUPAC name is [3-(4-bromo-3-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [3-(4-bromo-3-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 91278612 |
| Molecular Formula | C16H23BrFNO2Si |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [3-(4-bromo-3-fluorophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1C=C(c2ccc(Br)c(F)c2)NO1 |
| InChI | InChI=1S/C16H23BrFNO2Si/c1-16(2,3)22(4,5)20-10-12-9-15(19-21-12)11-6-7-13(17)14(18)8-11/h6-9,12,19H,10H2,1-5H3 |
| InChIKey | SWWUGTLNFZSMTL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|