C18H27BrNO5P — CID 91424418
[3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl ditert-butyl phosphate (PubChem CID 91424418) has the molecular formula C18H27BrNO5P and a molecular weight of 448.29 g/mol. Its IUPAC name is [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl ditert-butyl phosphate.
| Compound Name | [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl ditert-butyl phosphate |
|---|---|
| PubChem CID | 91424418 |
| Molecular Formula | C18H27BrNO5P |
| Molecular Weight | 448.29 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | [3-(4-bromophenyl)-2,5-dihydro-1,2-oxazol-5-yl]methyl ditert-butyl phosphate |
| SMILES | CC(C)(C)OP(=O)(OCC1C=C(c2ccc(Br)cc2)NO1)OC(C)(C)C |
| InChI | InChI=1S/C18H27BrNO5P/c1-17(2,3)24-26(21,25-18(4,5)6)22-12-15-11-16(20-23-15)13-7-9-14(19)10-8-13/h7-11,15,20H,12H2,1-6H3 |
| InChIKey | UIAPWFJXKPNBNY-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.29 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|