About 1-tert-butyl-1-methyl-2,4-di(propan-2-yl)cyclobutane
1-tert-butyl-1-methyl-2,4-di(propan-2-yl)cyclobutane (PubChem CID 91279351) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is 1-tert-butyl-1-methyl-2,4-di(propan-2-yl)cyclobutane.
Analyze 1-tert-butyl-1-methyl-2,4-di(propan-2-yl)cyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-1-methyl-2,4-di(propan-2-yl)cyclobutane?
The IUPAC name of 1-tert-butyl-1-methyl-2,4-di(propan-2-yl)cyclobutane (CID 91279351) is 1-tert-butyl-1-methyl-2,4-di(propan-2-yl)cyclobutane.
What is the SMILES notation for 1-tert-butyl-1-methyl-2,4-di(propan-2-yl)cyclobutane?
The canonical SMILES for 1-tert-butyl-1-methyl-2,4-di(propan-2-yl)cyclobutane is CC(C)C1CC(C(C)C)C1(C)C(C)(C)C.
What is the InChIKey of 1-tert-butyl-1-methyl-2,4-di(propan-2-yl)cyclobutane?
The InChIKey is FZZOYMQYXLAUGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30/c1-10(2)12-9-13(11(3)4)15(12,8)14(5,6)7/h10-13H,9H2,1-8H3.
What are the key properties of 1-tert-butyl-1-methyl-2,4-di(propan-2-yl)cyclobutane?
1-tert-butyl-1-methyl-2,4-di(propan-2-yl)cyclobutane has a molecular weight of 210.40 g/mol, XLogP of 4.99, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-1-methyl-2,4-di(propan-2-yl)cyclobutane is sourced from PubChem (CID 91279351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).