About 2-tert-butyl-1,1,2-trimethyl-3-propan-2-ylcyclobutane
2-tert-butyl-1,1,2-trimethyl-3-propan-2-ylcyclobutane (PubChem CID 123668668) has the molecular formula C14H28
and a molecular weight of 196.38 g/mol. Its IUPAC name is 2-tert-butyl-1,1,2-trimethyl-3-propan-2-ylcyclobutane.
Analyze 2-tert-butyl-1,1,2-trimethyl-3-propan-2-ylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,1,2-trimethyl-3-propan-2-ylcyclobutane?
The IUPAC name of 2-tert-butyl-1,1,2-trimethyl-3-propan-2-ylcyclobutane (CID 123668668) is 2-tert-butyl-1,1,2-trimethyl-3-propan-2-ylcyclobutane.
What is the SMILES notation for 2-tert-butyl-1,1,2-trimethyl-3-propan-2-ylcyclobutane?
The canonical SMILES for 2-tert-butyl-1,1,2-trimethyl-3-propan-2-ylcyclobutane is CC(C)C1CC(C)(C)C1(C)C(C)(C)C.
What is the InChIKey of 2-tert-butyl-1,1,2-trimethyl-3-propan-2-ylcyclobutane?
The InChIKey is NEJPVLLEIDXQTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28/c1-10(2)11-9-13(6,7)14(11,8)12(3,4)5/h10-11H,9H2,1-8H3.
What are the key properties of 2-tert-butyl-1,1,2-trimethyl-3-propan-2-ylcyclobutane?
2-tert-butyl-1,1,2-trimethyl-3-propan-2-ylcyclobutane has a molecular weight of 196.38 g/mol, XLogP of 4.74, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,1,2-trimethyl-3-propan-2-ylcyclobutane is sourced from PubChem (CID 123668668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).