About 1-tert-butyl-2,2-dimethyl-1-propan-2-ylcyclopropane
1-tert-butyl-2,2-dimethyl-1-propan-2-ylcyclopropane (PubChem CID 12600021) has the molecular formula C12H24
and a molecular weight of 168.32 g/mol. Its IUPAC name is 1-tert-butyl-2,2-dimethyl-1-propan-2-ylcyclopropane.
Analyze 1-tert-butyl-2,2-dimethyl-1-propan-2-ylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-2,2-dimethyl-1-propan-2-ylcyclopropane?
The IUPAC name of 1-tert-butyl-2,2-dimethyl-1-propan-2-ylcyclopropane (CID 12600021) is 1-tert-butyl-2,2-dimethyl-1-propan-2-ylcyclopropane.
What is the SMILES notation for 1-tert-butyl-2,2-dimethyl-1-propan-2-ylcyclopropane?
The canonical SMILES for 1-tert-butyl-2,2-dimethyl-1-propan-2-ylcyclopropane is CC(C)C1(C(C)(C)C)CC1(C)C.
What is the InChIKey of 1-tert-butyl-2,2-dimethyl-1-propan-2-ylcyclopropane?
The InChIKey is MAKLTCZYOYEVLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24/c1-9(2)12(10(3,4)5)8-11(12,6)7/h9H,8H2,1-7H3.
What are the key properties of 1-tert-butyl-2,2-dimethyl-1-propan-2-ylcyclopropane?
1-tert-butyl-2,2-dimethyl-1-propan-2-ylcyclopropane has a molecular weight of 168.32 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-2,2-dimethyl-1-propan-2-ylcyclopropane is sourced from PubChem (CID 12600021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).