C27H54 — CID 91314915
3-tert-butyl-2-(2,3-dimethylbutan-2-yl)-1,1,2,3,4-pentamethyl-4-(2,3,3-trimethylbutan-2-yl)cyclopentane (PubChem CID 91314915) has the molecular formula C27H54 and a molecular weight of 378.73 g/mol. Its IUPAC name is 3-tert-butyl-2-(2,3-dimethylbutan-2-yl)-1,1,2,3,4-pentamethyl-4-(2,3,3-trimethylbutan-2-yl)cyclopentane.
| Compound Name | 3-tert-butyl-2-(2,3-dimethylbutan-2-yl)-1,1,2,3,4-pentamethyl-4-(2,3,3-trimethylbutan-2-yl)cyclopentane |
|---|---|
| PubChem CID | 91314915 |
| Molecular Formula | C27H54 |
| Molecular Weight | 378.73 g/mol |
| Exact Mass | 378.42 |
| IUPAC Name | 3-tert-butyl-2-(2,3-dimethylbutan-2-yl)-1,1,2,3,4-pentamethyl-4-(2,3,3-trimethylbutan-2-yl)cyclopentane |
| SMILES | CC(C)C(C)(C)C1(C)C(C)(C)CC(C)(C(C)(C)C(C)(C)C)C1(C)C(C)(C)C |
| InChI | InChI=1S/C27H54/c1-19(2)23(11,12)27(17)22(9,10)18-25(15,24(13,14)20(3,4)5)26(27,16)21(6,7)8/h19H,18H2,1-17H3 |
| InChIKey | KCLILFOFAQGWLA-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.73 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |