C56H108 — CID 101044420
1,2,3,4,5,6,7,8-octakis(2,3-dimethylbutan-2-yl)tricyclo[4.2.0.02,5]octane (PubChem CID 101044420) has the molecular formula C56H108 and a molecular weight of 781.48 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8-octakis(2,3-dimethylbutan-2-yl)tricyclo[4.2.0.02,5]octane.
| Compound Name | 1,2,3,4,5,6,7,8-octakis(2,3-dimethylbutan-2-yl)tricyclo[4.2.0.02,5]octane |
|---|---|
| PubChem CID | 101044420 |
| Molecular Formula | C56H108 |
| Molecular Weight | 781.48 g/mol |
| Exact Mass | 780.85 |
| IUPAC Name | 1,2,3,4,5,6,7,8-octakis(2,3-dimethylbutan-2-yl)tricyclo[4.2.0.02,5]octane |
| SMILES | CC(C)C(C)(C)C1C(C(C)(C)C(C)C)C2(C(C)(C)C(C)C)C1(C(C)(C)C(C)C)C1(C(C)(C)C(C)C)C(C(C)(C)C(C)C)C(C(C)(C)C(C)C)C21C(C)(C)C(C)C |
| InChI | InChI=1S/C56H108/c1-33(2)45(17,18)41-42(46(19,20)34(3)4)54(50(27,28)38(11)12)53(41,49(25,26)37(9)10)55(51(29,30)39(13)14)43(47(21,22)35(5)6)44(48(23,24)36(7)8)56(54,55)52(31,32)40(15)16/h33-44H,1-32H3 |
| InChIKey | WIOOBACINVNJFT-UHFFFAOYSA-N |
| XLogP | 17.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.48 |
| LogP ≤ 5 | 17.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |