C24H48 — CID 162285091
3-(2-tert-butyl-3,3-dimethylbutyl)-1,1,2,2,4,4,5,5-octamethylcyclohexane (PubChem CID 162285091) has the molecular formula C24H48 and a molecular weight of 336.65 g/mol. Its IUPAC name is 3-(2-tert-butyl-3,3-dimethylbutyl)-1,1,2,2,4,4,5,5-octamethylcyclohexane.
| Compound Name | 3-(2-tert-butyl-3,3-dimethylbutyl)-1,1,2,2,4,4,5,5-octamethylcyclohexane |
|---|---|
| PubChem CID | 162285091 |
| Molecular Formula | C24H48 |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 336.38 |
| IUPAC Name | 3-(2-tert-butyl-3,3-dimethylbutyl)-1,1,2,2,4,4,5,5-octamethylcyclohexane |
| SMILES | CC(C)(C)C(CC1C(C)(C)C(C)(C)CC(C)(C)C1(C)C)C(C)(C)C |
| InChI | InChI=1S/C24H48/c1-19(2,3)17(20(4,5)6)15-18-23(11,12)21(7,8)16-22(9,10)24(18,13)14/h17-18H,15-16H2,1-14H3 |
| InChIKey | ILSFMXZHHMQVEY-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |