About 4-tert-butyl-1,2,2-trimethylbicyclo[2.2.0]hexane
4-tert-butyl-1,2,2-trimethylbicyclo[2.2.0]hexane (PubChem CID 162524647) has the molecular formula C13H24
and a molecular weight of 180.33 g/mol. Its IUPAC name is 4-tert-butyl-1,2,2-trimethylbicyclo[2.2.0]hexane.
Analyze 4-tert-butyl-1,2,2-trimethylbicyclo[2.2.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-1,2,2-trimethylbicyclo[2.2.0]hexane?
The IUPAC name of 4-tert-butyl-1,2,2-trimethylbicyclo[2.2.0]hexane (CID 162524647) is 4-tert-butyl-1,2,2-trimethylbicyclo[2.2.0]hexane.
What is the SMILES notation for 4-tert-butyl-1,2,2-trimethylbicyclo[2.2.0]hexane?
The canonical SMILES for 4-tert-butyl-1,2,2-trimethylbicyclo[2.2.0]hexane is CC(C)(C)C12CCC1(C)C(C)(C)C2.
What is the InChIKey of 4-tert-butyl-1,2,2-trimethylbicyclo[2.2.0]hexane?
The InChIKey is FJVQNJBJKRTENA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24/c1-10(2,3)13-8-7-12(13,6)11(4,5)9-13/h7-9H2,1-6H3.
What are the key properties of 4-tert-butyl-1,2,2-trimethylbicyclo[2.2.0]hexane?
4-tert-butyl-1,2,2-trimethylbicyclo[2.2.0]hexane has a molecular weight of 180.33 g/mol, XLogP of 4.25, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-1,2,2-trimethylbicyclo[2.2.0]hexane is sourced from PubChem (CID 162524647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).