C15H28 — CID 123928850
1-(2,2-dimethylpentan-3-yl)-2,2-dimethyl-1-prop-1-en-2-ylcyclopropane (PubChem CID 123928850) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 1-(2,2-dimethylpentan-3-yl)-2,2-dimethyl-1-prop-1-en-2-ylcyclopropane.
| Compound Name | 1-(2,2-dimethylpentan-3-yl)-2,2-dimethyl-1-prop-1-en-2-ylcyclopropane |
|---|---|
| PubChem CID | 123928850 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 1-(2,2-dimethylpentan-3-yl)-2,2-dimethyl-1-prop-1-en-2-ylcyclopropane |
| SMILES | C=C(C)C1(C(CC)C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C15H28/c1-9-12(13(4,5)6)15(11(2)3)10-14(15,7)8/h12H,2,9-10H2,1,3-8H3 |
| InChIKey | SUCHCJDKABRDRL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|