About 1-tert-butyl-1-(2,2-dimethylpentan-3-yl)cyclobutane
1-tert-butyl-1-(2,2-dimethylpentan-3-yl)cyclobutane (PubChem CID 165174323) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is 1-tert-butyl-1-(2,2-dimethylpentan-3-yl)cyclobutane.
Analyze 1-tert-butyl-1-(2,2-dimethylpentan-3-yl)cyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-1-(2,2-dimethylpentan-3-yl)cyclobutane?
The IUPAC name of 1-tert-butyl-1-(2,2-dimethylpentan-3-yl)cyclobutane (CID 165174323) is 1-tert-butyl-1-(2,2-dimethylpentan-3-yl)cyclobutane.
What is the SMILES notation for 1-tert-butyl-1-(2,2-dimethylpentan-3-yl)cyclobutane?
The canonical SMILES for 1-tert-butyl-1-(2,2-dimethylpentan-3-yl)cyclobutane is CCC(C(C)(C)C)C1(C(C)(C)C)CCC1.
What is the InChIKey of 1-tert-butyl-1-(2,2-dimethylpentan-3-yl)cyclobutane?
The InChIKey is DKDOKHXOGAJEAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30/c1-8-12(13(2,3)4)15(10-9-11-15)14(5,6)7/h12H,8-11H2,1-7H3.
What are the key properties of 1-tert-butyl-1-(2,2-dimethylpentan-3-yl)cyclobutane?
1-tert-butyl-1-(2,2-dimethylpentan-3-yl)cyclobutane has a molecular weight of 210.40 g/mol, XLogP of 5.28, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-1-(2,2-dimethylpentan-3-yl)cyclobutane is sourced from PubChem (CID 165174323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).