C20H36 — CID 142110282
2-ethyl-1,1-dimethyl-3-(2,6,7,7-tetramethyl-5-methylideneoct-1-en-3-yl)cyclopropane (PubChem CID 142110282) has the molecular formula C20H36 and a molecular weight of 276.51 g/mol. Its IUPAC name is 2-ethyl-1,1-dimethyl-3-(2,6,7,7-tetramethyl-5-methylideneoct-1-en-3-yl)cyclopropane.
| Compound Name | 2-ethyl-1,1-dimethyl-3-(2,6,7,7-tetramethyl-5-methylideneoct-1-en-3-yl)cyclopropane |
|---|---|
| PubChem CID | 142110282 |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.51 g/mol |
| Exact Mass | 276.28 |
| IUPAC Name | 2-ethyl-1,1-dimethyl-3-(2,6,7,7-tetramethyl-5-methylideneoct-1-en-3-yl)cyclopropane |
| SMILES | C=C(C)C(CC(=C)C(C)C(C)(C)C)C1C(CC)C1(C)C |
| InChI | InChI=1S/C20H36/c1-11-17-18(20(17,9)10)16(13(2)3)12-14(4)15(5)19(6,7)8/h15-18H,2,4,11-12H2,1,3,5-10H3 |
| InChIKey | YVMFHNDDFMELLK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.51 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|