C12H15F2N2- — CID 91281240
4-fluoro-7-(2-fluoroethyl)-6-propan-2-yl-3a,7a-dihydro-1H-benzimidazole (PubChem CID 91281240) has the molecular formula C12H15F2N2- and a molecular weight of 225.26 g/mol. Its IUPAC name is 4-fluoro-7-(2-fluoroethyl)-6-propan-2-yl-3a,7a-dihydro-1H-benzimidazole.
| Compound Name | 4-fluoro-7-(2-fluoroethyl)-6-propan-2-yl-3a,7a-dihydro-1H-benzimidazole |
|---|---|
| PubChem CID | 91281240 |
| Molecular Formula | C12H15F2N2- |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 4-fluoro-7-(2-fluoroethyl)-6-propan-2-yl-3a,7a-dihydro-1H-benzimidazole |
| SMILES | [CH2-]C(C)C1=C(CCF)C2NC=NC2C(F)=C1 |
| InChI | InChI=1S/C12H15F2N2/c1-7(2)9-5-10(14)12-11(15-6-16-12)8(9)3-4-13/h5-7,11-12H,1,3-4H2,2H3,(H,15,16)/q-1 |
| InChIKey | CANYFJMPMIDPEX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|