C8H11FN2 — CID 163582524
6-fluoro-5-methyl-3a,6,7,7a-tetrahydro-1H-benzimidazole (PubChem CID 163582524) has the molecular formula C8H11FN2 and a molecular weight of 154.19 g/mol. Its IUPAC name is 6-fluoro-5-methyl-3a,6,7,7a-tetrahydro-1H-benzimidazole.
| Compound Name | 6-fluoro-5-methyl-3a,6,7,7a-tetrahydro-1H-benzimidazole |
|---|---|
| PubChem CID | 163582524 |
| Molecular Formula | C8H11FN2 |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 6-fluoro-5-methyl-3a,6,7,7a-tetrahydro-1H-benzimidazole |
| SMILES | CC1=CC2N=CNC2CC1F |
| InChI | InChI=1S/C8H11FN2/c1-5-2-7-8(3-6(5)9)11-4-10-7/h2,4,6-8H,3H2,1H3,(H,10,11) |
| InChIKey | GISZIMZJUWRYIR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|