C26H29ClN4O5 — CID 91281765
3-[(6-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-cyclopentyl-6-[2-(2,4-dimethoxyphenyl)ethyl]oxane-2,4-dione (PubChem CID 91281765) has the molecular formula C26H29ClN4O5 and a molecular weight of 512.99 g/mol. Its IUPAC name is 3-[(6-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-cyclopentyl-6-[2-(2,4-dimethoxyphenyl)ethyl]oxane-2,4-dione.
| Compound Name | 3-[(6-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-cyclopentyl-6-[2-(2,4-dimethoxyphenyl)ethyl]oxane-2,4-dione |
|---|---|
| PubChem CID | 91281765 |
| Molecular Formula | C26H29ClN4O5 |
| Molecular Weight | 512.99 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 3-[(6-chloro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-6-cyclopentyl-6-[2-(2,4-dimethoxyphenyl)ethyl]oxane-2,4-dione |
| SMILES | COc1ccc(CCC2(C3CCCC3)CC(=O)C(Cc3nc4ncc(Cl)cn4n3)C(=O)O2)c(OC)c1 |
| InChI | InChI=1S/C26H29ClN4O5/c1-34-19-8-7-16(22(11-19)35-2)9-10-26(17-5-3-4-6-17)13-21(32)20(24(33)36-26)12-23-29-25-28-14-18(27)15-31(25)30-23/h7-8,11,14-15,17,20H,3-6,9-10,12-13H2,1-2H3 |
| InChIKey | RIAHPRMXYUZBHG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 104.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.99 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|