C15H18N6O — CID 91282505
6-[2-[[1-(2-cyanopyrrolidin-1-yl)-2-hydroxyethylidene]amino]ethylamino]pyridine-3-carbonitrile (PubChem CID 91282505) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is 6-[2-[[1-(2-cyanopyrrolidin-1-yl)-2-hydroxyethylidene]amino]ethylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[2-[[1-(2-cyanopyrrolidin-1-yl)-2-hydroxyethylidene]amino]ethylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 91282505 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 6-[2-[[1-(2-cyanopyrrolidin-1-yl)-2-hydroxyethylidene]amino]ethylamino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCC/N=C(\CO)N2CCCC2C#N)nc1 |
| InChI | InChI=1S/C15H18N6O/c16-8-12-3-4-14(20-10-12)18-5-6-19-15(11-22)21-7-1-2-13(21)9-17/h3-4,10,13,22H,1-2,5-7,11H2,(H,18,20)/b19-15+ |
| InChIKey | VLYXXPFAXAYKOI-XDJHFCHBSA-N |
| XLogP | 0.74 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|