C10H15N3O — CID 91284386
1-(3,5-dimethylpyrazol-1-yl)-4-iminopentan-2-one (PubChem CID 91284386) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-(3,5-dimethylpyrazol-1-yl)-4-iminopentan-2-one.
| Compound Name | 1-(3,5-dimethylpyrazol-1-yl)-4-iminopentan-2-one |
|---|---|
| PubChem CID | 91284386 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 1-(3,5-dimethylpyrazol-1-yl)-4-iminopentan-2-one |
| SMILES | [H]/N=C(\C)CC(=O)Cn1nc(C)cc1C |
| InChI | InChI=1S/C10H15N3O/c1-7(11)4-10(14)6-13-9(3)5-8(2)12-13/h5,11H,4,6H2,1-3H3/b11-7+ |
| InChIKey | ARHJHCGZUVSPAV-YRNVUSSQSA-N |
| XLogP | 1.50 |
| TPSA | 58.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|