About 2-(3,6-dihydro-2H-pyran-4-yl)propanal
2-(3,6-dihydro-2H-pyran-4-yl)propanal (PubChem CID 91285053) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyran-4-yl)propanal.
Molecular Properties
| Compound Name | 2-(3,6-dihydro-2H-pyran-4-yl)propanal |
| PubChem CID | 91285053 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyran-4-yl)propanal |
| SMILES | CC(C=O)C1=CCOCC1 |
| InChI | InChI=1S/C8H12O2/c1-7(6-9)8-2-4-10-5-3-8/h2,6-7H,3-5H2,1H3 |
| InChIKey | BBLFEDHTHFWWQR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,6-dihydro-2H-pyran-4-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,6-dihydro-2H-pyran-4-yl)propanal?
The IUPAC name of 2-(3,6-dihydro-2H-pyran-4-yl)propanal (CID 91285053) is 2-(3,6-dihydro-2H-pyran-4-yl)propanal.
What is the SMILES notation for 2-(3,6-dihydro-2H-pyran-4-yl)propanal?
The canonical SMILES for 2-(3,6-dihydro-2H-pyran-4-yl)propanal is CC(C=O)C1=CCOCC1.
What is the InChIKey of 2-(3,6-dihydro-2H-pyran-4-yl)propanal?
The InChIKey is BBLFEDHTHFWWQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-7(6-9)8-2-4-10-5-3-8/h2,6-7H,3-5H2,1H3.
What are the key properties of 2-(3,6-dihydro-2H-pyran-4-yl)propanal?
2-(3,6-dihydro-2H-pyran-4-yl)propanal has a molecular weight of 140.18 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,6-dihydro-2H-pyran-4-yl)propanal is sourced from PubChem (CID 91285053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).