C11H18FNO2 — CID 91287349
2-(dimethylamino)-2-[2-(fluoromethyl)cyclohexa-1,3-dien-1-yl]ethane-1,1-diol (PubChem CID 91287349) has the molecular formula C11H18FNO2 and a molecular weight of 215.27 g/mol. Its IUPAC name is 2-(dimethylamino)-2-[2-(fluoromethyl)cyclohexa-1,3-dien-1-yl]ethane-1,1-diol.
| Compound Name | 2-(dimethylamino)-2-[2-(fluoromethyl)cyclohexa-1,3-dien-1-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 91287349 |
| Molecular Formula | C11H18FNO2 |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-(dimethylamino)-2-[2-(fluoromethyl)cyclohexa-1,3-dien-1-yl]ethane-1,1-diol |
| SMILES | CN(C)C(C1=C(CF)C=CCC1)C(O)O |
| InChI | InChI=1S/C11H18FNO2/c1-13(2)10(11(14)15)9-6-4-3-5-8(9)7-12/h3,5,10-11,14-15H,4,6-7H2,1-2H3 |
| InChIKey | NVZZDDFWBGSZMB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|