About 1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane
1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane (PubChem CID 91288935) has the molecular formula C13H23NO
and a molecular weight of 209.33 g/mol. Its IUPAC name is 1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane |
| PubChem CID | 91288935 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane |
| SMILES | CC1CC(C)CC(CCCCN=C=O)C1 |
| InChI | InChI=1S/C13H23NO/c1-11-7-12(2)9-13(8-11)5-3-4-6-14-10-15/h11-13H,3-9H2,1-2H3 |
| InChIKey | XCQDWMBXLRJLIB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane?
The IUPAC name of 1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane (CID 91288935) is 1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane.
What is the SMILES notation for 1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane?
The canonical SMILES for 1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane is CC1CC(C)CC(CCCCN=C=O)C1.
What is the InChIKey of 1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane?
The InChIKey is XCQDWMBXLRJLIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO/c1-11-7-12(2)9-13(8-11)5-3-4-6-14-10-15/h11-13H,3-9H2,1-2H3.
What are the key properties of 1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane?
1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane has a molecular weight of 209.33 g/mol, XLogP of 3.56, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-isocyanatobutyl)-3,5-dimethylcyclohexane is sourced from PubChem (CID 91288935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).