C25H19F3N4O3 — CID 91288953
4-[[7-[[3-amino-5-(trifluoromethyl)phenyl]carbamoyl]naphthalen-2-yl]oxymethyl]pyridine-2-carboxamide (PubChem CID 91288953) has the molecular formula C25H19F3N4O3 and a molecular weight of 480.45 g/mol. Its IUPAC name is 4-[[7-[[3-amino-5-(trifluoromethyl)phenyl]carbamoyl]naphthalen-2-yl]oxymethyl]pyridine-2-carboxamide.
| Compound Name | 4-[[7-[[3-amino-5-(trifluoromethyl)phenyl]carbamoyl]naphthalen-2-yl]oxymethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 91288953 |
| Molecular Formula | C25H19F3N4O3 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 4-[[7-[[3-amino-5-(trifluoromethyl)phenyl]carbamoyl]naphthalen-2-yl]oxymethyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(COc2ccc3ccc(C(=O)Nc4cc(N)cc(C(F)(F)F)c4)cc3c2)ccn1 |
| InChI | InChI=1S/C25H19F3N4O3/c26-25(27,28)18-10-19(29)12-20(11-18)32-24(34)16-2-1-15-3-4-21(9-17(15)8-16)35-13-14-5-6-31-22(7-14)23(30)33/h1-12H,13,29H2,(H2,30,33)(H,32,34) |
| InChIKey | GKUKTEOEULPYOI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|