C23H37N5O4S — CID 91289636
N-[3-(3-cyclopropylprop-2-ynylamino)-2-hydroxypropyl]-2-[methyl(propan-2-ylsulfonyl)amino]-6-(2-methylpropylamino)pyridine-4-carboxamide (PubChem CID 91289636) has the molecular formula C23H37N5O4S and a molecular weight of 479.65 g/mol. Its IUPAC name is N-[3-(3-cyclopropylprop-2-ynylamino)-2-hydroxypropyl]-2-[methyl(propan-2-ylsulfonyl)amino]-6-(2-methylpropylamino)pyridine-4-carboxamide.
| Compound Name | N-[3-(3-cyclopropylprop-2-ynylamino)-2-hydroxypropyl]-2-[methyl(propan-2-ylsulfonyl)amino]-6-(2-methylpropylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 91289636 |
| Molecular Formula | C23H37N5O4S |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | N-[3-(3-cyclopropylprop-2-ynylamino)-2-hydroxypropyl]-2-[methyl(propan-2-ylsulfonyl)amino]-6-(2-methylpropylamino)pyridine-4-carboxamide |
| SMILES | CC(C)CNc1cc(C(=O)NCC(O)CNCC#CC2CC2)cc(N(C)S(=O)(=O)C(C)C)n1 |
| InChI | InChI=1S/C23H37N5O4S/c1-16(2)13-25-21-11-19(12-22(27-21)28(5)33(31,32)17(3)4)23(30)26-15-20(29)14-24-10-6-7-18-8-9-18/h11-12,16-18,20,24,29H,8-10,13-15H2,1-5H3,(H,25,27)(H,26,30) |
| InChIKey | LRTWPGXAUAHOIB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 123.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|