C23H32N2O2 — CID 91289743
5-butoxy-N-[(1S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-indole-2-carboxamide (PubChem CID 91289743) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 5-butoxy-N-[(1S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-indole-2-carboxamide.
| Compound Name | 5-butoxy-N-[(1S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 91289743 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 5-butoxy-N-[(1S)-1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl]-1H-indole-2-carboxamide |
| SMILES | CCCCOc1ccc2[nH]c(C(=O)NC3C(C)(C)C4CC[C@@]3(C)C4)cc2c1 |
| InChI | InChI=1S/C23H32N2O2/c1-5-6-11-27-17-7-8-18-15(12-17)13-19(24-18)20(26)25-21-22(2,3)16-9-10-23(21,4)14-16/h7-8,12-13,16,21,24H,5-6,9-11,14H2,1-4H3,(H,25,26)/t16?,21?,23-/m0/s1 |
| InChIKey | DORIANCMLBDLJG-WWRGRJRASA-N |
| XLogP | 5.29 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|