C22H26FNO3S2 — CID 91290116
6-fluoro-N-(oxan-4-ylmethyl)-2-propan-2-yl-9H-thioxanthene-3-sulfonamide (PubChem CID 91290116) has the molecular formula C22H26FNO3S2 and a molecular weight of 435.59 g/mol. Its IUPAC name is 6-fluoro-N-(oxan-4-ylmethyl)-2-propan-2-yl-9H-thioxanthene-3-sulfonamide.
| Compound Name | 6-fluoro-N-(oxan-4-ylmethyl)-2-propan-2-yl-9H-thioxanthene-3-sulfonamide |
|---|---|
| PubChem CID | 91290116 |
| Molecular Formula | C22H26FNO3S2 |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 6-fluoro-N-(oxan-4-ylmethyl)-2-propan-2-yl-9H-thioxanthene-3-sulfonamide |
| SMILES | CC(C)c1cc2c(cc1S(=O)(=O)NCC1CCOCC1)Sc1cc(F)ccc1C2 |
| InChI | InChI=1S/C22H26FNO3S2/c1-14(2)19-10-17-9-16-3-4-18(23)11-20(16)28-21(17)12-22(19)29(25,26)24-13-15-5-7-27-8-6-15/h3-4,10-12,14-15,24H,5-9,13H2,1-2H3 |
| InChIKey | CUSNNCWMLVMHAJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |