C18H18FNO4S2 — CID 90961856
8-fluoro-3-methyl-N-(oxan-4-yl)phenoxathiine-2-sulfonamide (PubChem CID 90961856) has the molecular formula C18H18FNO4S2 and a molecular weight of 395.48 g/mol. Its IUPAC name is 8-fluoro-3-methyl-N-(oxan-4-yl)phenoxathiine-2-sulfonamide.
| Compound Name | 8-fluoro-3-methyl-N-(oxan-4-yl)phenoxathiine-2-sulfonamide |
|---|---|
| PubChem CID | 90961856 |
| Molecular Formula | C18H18FNO4S2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 8-fluoro-3-methyl-N-(oxan-4-yl)phenoxathiine-2-sulfonamide |
| SMILES | Cc1cc2c(cc1S(=O)(=O)NC1CCOCC1)Sc1cc(F)ccc1O2 |
| InChI | InChI=1S/C18H18FNO4S2/c1-11-8-15-17(25-16-9-12(19)2-3-14(16)24-15)10-18(11)26(21,22)20-13-4-6-23-7-5-13/h2-3,8-10,13,20H,4-7H2,1H3 |
| InChIKey | HDJGGRDAVOYGSX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |