C43H51N5O5 — CID 91290341
[2-(dibenzylamino)-3-phenylpropyl] 4-[3-[2-formamido-2-[(2-methylpropan-2-yl)oxy]ethyl]-2-oxobenzimidazol-1-yl]piperidine-1-carboxylate (PubChem CID 91290341) has the molecular formula C43H51N5O5 and a molecular weight of 717.91 g/mol. Its IUPAC name is [2-(dibenzylamino)-3-phenylpropyl] 4-[3-[2-formamido-2-[(2-methylpropan-2-yl)oxy]ethyl]-2-oxobenzimidazol-1-yl]piperidine-1-carboxylate.
| Compound Name | [2-(dibenzylamino)-3-phenylpropyl] 4-[3-[2-formamido-2-[(2-methylpropan-2-yl)oxy]ethyl]-2-oxobenzimidazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91290341 |
| Molecular Formula | C43H51N5O5 |
| Molecular Weight | 717.91 g/mol |
| Exact Mass | 717.39 |
| IUPAC Name | [2-(dibenzylamino)-3-phenylpropyl] 4-[3-[2-formamido-2-[(2-methylpropan-2-yl)oxy]ethyl]-2-oxobenzimidazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(Cn1c(=O)n(C2CCN(C(=O)OCC(Cc3ccccc3)N(Cc3ccccc3)Cc3ccccc3)CC2)c2ccccc21)NC=O |
| InChI | InChI=1S/C43H51N5O5/c1-43(2,3)53-40(44-32-49)30-47-38-21-13-14-22-39(38)48(41(47)50)36-23-25-45(26-24-36)42(51)52-31-37(27-33-15-7-4-8-16-33)46(28-34-17-9-5-10-18-34)29-35-19-11-6-12-20-35/h4-22,32,36-37,40H,23-31H2,1-3H3,(H,44,49) |
| InChIKey | JBALLYLPXZGBLP-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.91 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|