C17H13ClF2O3 — CID 91293118
ethyl 2-(4-chlorophenyl)-3-(3,5-difluorophenoxy)prop-2-enoate (PubChem CID 91293118) has the molecular formula C17H13ClF2O3 and a molecular weight of 338.74 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)-3-(3,5-difluorophenoxy)prop-2-enoate.
| Compound Name | ethyl 2-(4-chlorophenyl)-3-(3,5-difluorophenoxy)prop-2-enoate |
|---|---|
| PubChem CID | 91293118 |
| Molecular Formula | C17H13ClF2O3 |
| Molecular Weight | 338.74 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)-3-(3,5-difluorophenoxy)prop-2-enoate |
| SMILES | CCOC(=O)C(=COc1cc(F)cc(F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClF2O3/c1-2-22-17(21)16(11-3-5-12(18)6-4-11)10-23-15-8-13(19)7-14(20)9-15/h3-10H,2H2,1H3 |
| InChIKey | ODAVRETXUCWCCQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.74 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|