C20H22ClN3O4S — CID 91293221
(5-chlorothiophen-2-yl) N-[[1-(4-morpholin-4-ylphenyl)-5-oxopyrrolidin-3-yl]methyl]carbamate (PubChem CID 91293221) has the molecular formula C20H22ClN3O4S and a molecular weight of 435.93 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl) N-[[1-(4-morpholin-4-ylphenyl)-5-oxopyrrolidin-3-yl]methyl]carbamate.
| Compound Name | (5-chlorothiophen-2-yl) N-[[1-(4-morpholin-4-ylphenyl)-5-oxopyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 91293221 |
| Molecular Formula | C20H22ClN3O4S |
| Molecular Weight | 435.93 g/mol |
| Exact Mass | 435.10 |
| IUPAC Name | (5-chlorothiophen-2-yl) N-[[1-(4-morpholin-4-ylphenyl)-5-oxopyrrolidin-3-yl]methyl]carbamate |
| SMILES | O=C(NCC1CC(=O)N(c2ccc(N3CCOCC3)cc2)C1)Oc1ccc(Cl)s1 |
| InChI | InChI=1S/C20H22ClN3O4S/c21-17-5-6-19(29-17)28-20(26)22-12-14-11-18(25)24(13-14)16-3-1-15(2-4-16)23-7-9-27-10-8-23/h1-6,14H,7-13H2,(H,22,26) |
| InChIKey | ACLDNCBKFNAUGV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.93 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|