C19H24O4 — CID 91295007
2-ethyl-2-methyl-6-methylidenepyran-3-one;7-methylidene-6-oxaspiro[4.5]dec-8-en-10-one (PubChem CID 91295007) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-ethyl-2-methyl-6-methylidenepyran-3-one;7-methylidene-6-oxaspiro[4.5]dec-8-en-10-one.
| Compound Name | 2-ethyl-2-methyl-6-methylidenepyran-3-one;7-methylidene-6-oxaspiro[4.5]dec-8-en-10-one |
|---|---|
| PubChem CID | 91295007 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-ethyl-2-methyl-6-methylidenepyran-3-one;7-methylidene-6-oxaspiro[4.5]dec-8-en-10-one |
| SMILES | C=C1C=CC(=O)C(C)(CC)O1.C=C1C=CC(=O)C2(CCCC2)O1 |
| InChI | InChI=1S/C10H12O2.C9H12O2/c1-8-4-5-9(11)10(12-8)6-2-3-7-10;1-4-9(3)8(10)6-5-7(2)11-9/h4-5H,1-3,6-7H2;5-6H,2,4H2,1,3H3 |
| InChIKey | FVJSISLJHULHBM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |