C19H33N2O+ — CID 9129750
[(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium (PubChem CID 9129750) has the molecular formula C19H33N2O+ and a molecular weight of 305.49 g/mol. Its IUPAC name is [(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium.
| Compound Name | [(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 9129750 |
| Molecular Formula | C19H33N2O+ |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.26 |
| IUPAC Name | [(1S)-1-(4-tert-butylphenyl)-2-methylpropyl]-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]azanium |
| SMILES | CCNC(=O)[C@H](C)[NH2+][C@H](c1ccc(C(C)(C)C)cc1)C(C)C |
| InChI | InChI=1S/C19H32N2O/c1-8-20-18(22)14(4)21-17(13(2)3)15-9-11-16(12-10-15)19(5,6)7/h9-14,17,21H,8H2,1-7H3,(H,20,22)/p+1/t14-,17-/m0/s1 |
| InChIKey | SJFLATMFDZKJAN-YOEHRIQHSA-O |
| XLogP | 2.77 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |