C11H9ClFNO2 — CID 91299353
2-chloro-1-[5-(2-fluorophenyl)-2,5-dihydro-1,2-oxazol-3-yl]ethanone (PubChem CID 91299353) has the molecular formula C11H9ClFNO2 and a molecular weight of 241.65 g/mol. Its IUPAC name is 2-chloro-1-[5-(2-fluorophenyl)-2,5-dihydro-1,2-oxazol-3-yl]ethanone.
| Compound Name | 2-chloro-1-[5-(2-fluorophenyl)-2,5-dihydro-1,2-oxazol-3-yl]ethanone |
|---|---|
| PubChem CID | 91299353 |
| Molecular Formula | C11H9ClFNO2 |
| Molecular Weight | 241.65 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | 2-chloro-1-[5-(2-fluorophenyl)-2,5-dihydro-1,2-oxazol-3-yl]ethanone |
| SMILES | O=C(CCl)C1=CC(c2ccccc2F)ON1 |
| InChI | InChI=1S/C11H9ClFNO2/c12-6-10(15)9-5-11(16-14-9)7-3-1-2-4-8(7)13/h1-5,11,14H,6H2 |
| InChIKey | BKDGGPDUMFJSQF-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.65 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|