C13H18Cl2N8 — CID 91300320
3,3-bis(5-amino-6-chloropyrimidin-4-yl)pentane-1,4-diamine (PubChem CID 91300320) has the molecular formula C13H18Cl2N8 and a molecular weight of 357.25 g/mol. Its IUPAC name is 3,3-bis(5-amino-6-chloropyrimidin-4-yl)pentane-1,4-diamine.
| Compound Name | 3,3-bis(5-amino-6-chloropyrimidin-4-yl)pentane-1,4-diamine |
|---|---|
| PubChem CID | 91300320 |
| Molecular Formula | C13H18Cl2N8 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 3,3-bis(5-amino-6-chloropyrimidin-4-yl)pentane-1,4-diamine |
| SMILES | CC(N)C(CCN)(c1ncnc(Cl)c1N)c1ncnc(Cl)c1N |
| InChI | InChI=1S/C13H18Cl2N8/c1-6(17)13(2-3-16,9-7(18)11(14)22-4-20-9)10-8(19)12(15)23-5-21-10/h4-6H,2-3,16-19H2,1H3 |
| InChIKey | LGJJXJHWKKGJTR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 155.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |