About 4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine
4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine (PubChem CID 159878349) has the molecular formula C11H13Cl3N6
and a molecular weight of 335.63 g/mol. Its IUPAC name is 4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine.
Molecular Properties
| Compound Name | 4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine |
| PubChem CID | 159878349 |
| Molecular Formula | C11H13Cl3N6 |
| Molecular Weight | 335.63 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine |
| SMILES | CC(C)c1ncnc(Cl)c1N.Nc1c(Cl)ncnc1Cl |
| InChI | InChI=1S/C7H10ClN3.C4H3Cl2N3/c1-4(2)6-5(9)7(8)11-3-10-6;5-3-2(7)4(6)9-1-8-3/h3-4H,9H2,1-2H3;1H,7H2 |
| InChIKey | NTEYKLKVQQAEQF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.63 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine?
The IUPAC name of 4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine (CID 159878349) is 4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine.
What is the SMILES notation for 4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine?
The canonical SMILES for 4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine is CC(C)c1ncnc(Cl)c1N.Nc1c(Cl)ncnc1Cl.
What is the InChIKey of 4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine?
The InChIKey is NTEYKLKVQQAEQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3.C4H3Cl2N3/c1-4(2)6-5(9)7(8)11-3-10-6;5-3-2(7)4(6)9-1-8-3/h3-4H,9H2,1-2H3;1H,7H2.
What are the key properties of 4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine?
4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine has a molecular weight of 335.63 g/mol, XLogP of 3.20, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-propan-2-ylpyrimidin-5-amine;4,6-dichloropyrimidin-5-amine is sourced from PubChem (CID 159878349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).