C6H8ClN3 — CID 116822816
5-chloro-6-propan-2-yl-1,2,4-triazine (PubChem CID 116822816) has the molecular formula C6H8ClN3 and a molecular weight of 157.60 g/mol. Its IUPAC name is 5-chloro-6-propan-2-yl-1,2,4-triazine.
| Compound Name | 5-chloro-6-propan-2-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 116822816 |
| Molecular Formula | C6H8ClN3 |
| Molecular Weight | 157.60 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 5-chloro-6-propan-2-yl-1,2,4-triazine |
| SMILES | CC(C)c1nncnc1Cl |
| InChI | InChI=1S/C6H8ClN3/c1-4(2)5-6(7)8-3-9-10-5/h3-4H,1-2H3 |
| InChIKey | XRRSRAJJDILIIC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.60 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |