C7H9Cl2N3S — CID 175149858
2-(4,6-dichloropyrimidin-5-yl)sulfanylpropan-1-amine (PubChem CID 175149858) has the molecular formula C7H9Cl2N3S and a molecular weight of 238.14 g/mol. Its IUPAC name is 2-(4,6-dichloropyrimidin-5-yl)sulfanylpropan-1-amine.
| Compound Name | 2-(4,6-dichloropyrimidin-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 175149858 |
| Molecular Formula | C7H9Cl2N3S |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 2-(4,6-dichloropyrimidin-5-yl)sulfanylpropan-1-amine |
| SMILES | CC(CN)Sc1c(Cl)ncnc1Cl |
| InChI | InChI=1S/C7H9Cl2N3S/c1-4(2-10)13-5-6(8)11-3-12-7(5)9/h3-4H,2,10H2,1H3 |
| InChIKey | VQUHOCCNQHHCEN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |