(9R)-9-hydroperoxyoctadeca-2,4-dienoic acid

C18H32O4 — CID 91301274

IUPAC(9R)-9-hydroperoxyoctadeca-2,4-dienoic acid
SMILESCCCCCCCCC[C@H](CCCC=CC=CC(=O)O)OO
InChIInChI=1S/C18H32O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h7,10,13,16-17,21H,2-6,8-9,11-12,14-15H2,1H3,(H,19,20)/t17-/m1/s1
InChIKeyXDPDIOHFEPDAFI-QGZVFWFLSA-N
MW312.45 g/mol
LogP5.35
Rot. Bonds15

About (9R)-9-hydroperoxyoctadeca-2,4-dienoic acid

(9R)-9-hydroperoxyoctadeca-2,4-dienoic acid (PubChem CID 91301274) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is (9R)-9-hydroperoxyoctadeca-2,4-dienoic acid.

Molecular Properties

Compound Name(9R)-9-hydroperoxyoctadeca-2,4-dienoic acid
PubChem CID91301274
Molecular FormulaC18H32O4
Molecular Weight312.45 g/mol
Exact Mass312.23
IUPAC Name(9R)-9-hydroperoxyoctadeca-2,4-dienoic acid
SMILESCCCCCCCCC[C@H](CCCC=CC=CC(=O)O)OO
InChIInChI=1S/C18H32O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h7,10,13,16-17,21H,2-6,8-9,11-12,14-15H2,1H3,(H,19,20)/t17-/m1/s1
InChIKeyXDPDIOHFEPDAFI-QGZVFWFLSA-N
XLogP5.35
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds15
Heavy Atoms22
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500312.45
LogP ≤ 55.35
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (9R)-9-hydroperoxyoctadeca-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

11-hydroperoxyoctadeca-2,4,6-trienoic acid
CID 91259730
15-hydroperoxyicosa-2,4-dienoic acid
CID 123617978
(13S)-13-hydroperoxyoctadeca-2,4,6-trienoic acid
CID 56627844
9-(trioxidanyl)octadeca-2,4-dienoic acid
CID 173047990
15-(trioxidanyl)icosa-2,4,6,8-tetraenoic acid
CID 74016636
(2E,4E)-icosa-2,4-dienoic acid
CID 11483665
(2E,4E)-tetracosa-2,4-dienoic acid
CID 19784025
(2E,4E)-undeca-2,4-dienoic acid
CID 5312374
triaconta-2,4-dienoic acid
CID 54201076
pentadeca-2,4-dienoic acid
CID 54493784
(17S)-17-hydroxydocosa-2,4,6,8,10,12-hexaenoic acid
CID 54157203
(2E,4E,6E,8E,10E,12Z)-docosa-2,4,6,8,10,12-hexaenoic acid
CID 122652013

Frequently Asked Questions

What is the IUPAC name of (9R)-9-hydroperoxyoctadeca-2,4-dienoic acid?
The IUPAC name of (9R)-9-hydroperoxyoctadeca-2,4-dienoic acid (CID 91301274) is (9R)-9-hydroperoxyoctadeca-2,4-dienoic acid.
What is the SMILES notation for (9R)-9-hydroperoxyoctadeca-2,4-dienoic acid?
The canonical SMILES for (9R)-9-hydroperoxyoctadeca-2,4-dienoic acid is CCCCCCCCC[C@H](CCCC=CC=CC(=O)O)OO.
What is the InChIKey of (9R)-9-hydroperoxyoctadeca-2,4-dienoic acid?
The InChIKey is XDPDIOHFEPDAFI-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H32O4/c1-2-3-4-5-6-8-11-14-17(22-21)15-12-9-7-10-13-16-18(19)20/h7,10,13,16-17,21H,2-6,8-9,11-12,14-15H2,1H3,(H,19,20)/t17-/m1/s1.
What are the key properties of (9R)-9-hydroperoxyoctadeca-2,4-dienoic acid?
(9R)-9-hydroperoxyoctadeca-2,4-dienoic acid has a molecular weight of 312.45 g/mol, XLogP of 5.35, 15 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9R)-9-hydroperoxyoctadeca-2,4-dienoic acid is sourced from PubChem (CID 91301274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).